C21H26N6O4 — CID 162650238
2-[5-amino-3-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 162650238) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[5-amino-3-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[5-amino-3-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 162650238 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-[5-amino-3-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | COc1cc(-c2nc(N)n(CC(=O)Nc3ccc(N(C)C)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N6O4/c1-26(2)15-8-6-14(7-9-15)23-18(28)12-27-21(22)24-20(25-27)13-10-16(29-3)19(31-5)17(11-13)30-4/h6-11H,12H2,1-5H3,(H,23,28)(H2,22,24,25) |
| InChIKey | LSLZFPRQYZRFDW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|