C22H18BrF3N6O — CID 162651148
4-(3-bromoanilino)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 162651148) has the molecular formula C22H18BrF3N6O and a molecular weight of 519.33 g/mol. Its IUPAC name is 4-(3-bromoanilino)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(3-bromoanilino)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 162651148 |
| Molecular Formula | C22H18BrF3N6O |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 4-(3-bromoanilino)-N-[(E)-[3-(trifluoromethyl)phenyl]methylideneamino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(C(F)(F)F)c1)N1CCc2ncnc(Nc3cccc(Br)c3)c2C1 |
| InChI | InChI=1S/C22H18BrF3N6O/c23-16-5-2-6-17(10-16)30-20-18-12-32(8-7-19(18)27-13-28-20)21(33)31-29-11-14-3-1-4-15(9-14)22(24,25)26/h1-6,9-11,13H,7-8,12H2,(H,31,33)(H,27,28,30)/b29-11+ |
| InChIKey | OOKOFNUYCBFVDX-VPUKRXIYSA-N |
| XLogP | 5.10 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|