C9H10Li2NO3PS — CID 162651275
dilithium;(2S)-2-[[oxido(phenyl)phosphinothioyl]amino]propanoate (PubChem CID 162651275) has the molecular formula C9H10Li2NO3PS and a molecular weight of 257.11 g/mol. Its IUPAC name is dilithium;(2S)-2-[[oxido(phenyl)phosphinothioyl]amino]propanoate.
| Compound Name | dilithium;(2S)-2-[[oxido(phenyl)phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 162651275 |
| Molecular Formula | C9H10Li2NO3PS |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | dilithium;(2S)-2-[[oxido(phenyl)phosphinothioyl]amino]propanoate |
| SMILES | C[C@H](NP([O-])(=S)c1ccccc1)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C9H12NO3PS.2Li/c1-7(9(11)12)10-14(13,15)8-5-3-2-4-6-8;;/h2-7H,1H3,(H,11,12)(H2,10,13,15);;/q;2*+1/p-2/t7-,14?;;/m0../s1 |
| InChIKey | HWWNLGOCGQLDHE-ZNXLSLGMSA-L |
| XLogP | -7.28 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | -7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|