C11H14Li2NO3PS — CID 162652492
dilithium;(2S)-3-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]butanoate (PubChem CID 162652492) has the molecular formula C11H14Li2NO3PS and a molecular weight of 285.16 g/mol. Its IUPAC name is dilithium;(2S)-3-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]butanoate.
| Compound Name | dilithium;(2S)-3-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]butanoate |
|---|---|
| PubChem CID | 162652492 |
| Molecular Formula | C11H14Li2NO3PS |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | dilithium;(2S)-3-methyl-2-[[oxido(phenyl)phosphinothioyl]amino]butanoate |
| SMILES | CC(C)[C@H](NP([O-])(=S)c1ccccc1)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C11H16NO3PS.2Li/c1-8(2)10(11(13)14)12-16(15,17)9-6-4-3-5-7-9;;/h3-8,10H,1-2H3,(H,13,14)(H2,12,15,17);;/q;2*+1/p-2/t10-,16?;;/m0../s1 |
| InChIKey | UZMPXGMDHGFDGY-XUERHAGNSA-L |
| XLogP | -6.65 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|