C24H21N5O2S — CID 162651474
(E)-N-[3-[[2-(3-cyanoanilino)-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-4-yl]oxy]phenyl]but-2-enamide (PubChem CID 162651474) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is (E)-N-[3-[[2-(3-cyanoanilino)-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-4-yl]oxy]phenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[[2-(3-cyanoanilino)-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-4-yl]oxy]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 162651474 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (E)-N-[3-[[2-(3-cyanoanilino)-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-4-yl]oxy]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc(Oc2nc(Nc3cccc(C#N)c3)nc3c2CSCC3)c1 |
| InChI | InChI=1S/C24H21N5O2S/c1-2-5-22(30)26-18-8-4-9-19(13-18)31-23-20-15-32-11-10-21(20)28-24(29-23)27-17-7-3-6-16(12-17)14-25/h2-9,12-13H,10-11,15H2,1H3,(H,26,30)(H,27,28,29)/b5-2+ |
| InChIKey | RSXSGLJPCAOGCE-GORDUTHDSA-N |
| XLogP | 5.19 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|