C23H20N4O3S — CID 162675094
(E)-N-[3-[2-(3-methoxyanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]but-2-enamide (PubChem CID 162675094) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is (E)-N-[3-[2-(3-methoxyanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[2-(3-methoxyanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]but-2-enamide |
|---|---|
| PubChem CID | 162675094 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (E)-N-[3-[2-(3-methoxyanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc(Oc2nc(Nc3cccc(OC)c3)nc3ccsc23)c1 |
| InChI | InChI=1S/C23H20N4O3S/c1-3-6-20(28)24-15-7-5-10-18(14-15)30-22-21-19(11-12-31-21)26-23(27-22)25-16-8-4-9-17(13-16)29-2/h3-14H,1-2H3,(H,24,28)(H,25,26,27)/b6-3+ |
| InChIKey | YRWSYUOKYHJMNG-ZZXKWVIFSA-N |
| XLogP | 5.75 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|