C21H19N5O3S2 — CID 157227201
N-[3-[2-[(6-methylsulfanyl-3-pyridinyl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide;hydrate (PubChem CID 157227201) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[3-[2-[(6-methylsulfanyl-3-pyridinyl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide;hydrate.
| Compound Name | N-[3-[2-[(6-methylsulfanyl-3-pyridinyl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide;hydrate |
|---|---|
| PubChem CID | 157227201 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-[3-[2-[(6-methylsulfanyl-3-pyridinyl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide;hydrate |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(SC)nc3)nc3ccsc23)c1.O |
| InChI | InChI=1S/C21H17N5O2S2.H2O/c1-3-17(27)23-13-5-4-6-15(11-13)28-20-19-16(9-10-30-19)25-21(26-20)24-14-7-8-18(29-2)22-12-14;/h3-12H,1H2,2H3,(H,23,27)(H,24,25,26);1H2 |
| InChIKey | UOBFEIIVOCXYIX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|