C24H23N4O5PS — CID 56646772
N-[3-[2-[4-(dimethoxyphosphorylmethyl)anilino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 56646772) has the molecular formula C24H23N4O5PS and a molecular weight of 510.51 g/mol. Its IUPAC name is N-[3-[2-[4-(dimethoxyphosphorylmethyl)anilino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-(dimethoxyphosphorylmethyl)anilino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56646772 |
| Molecular Formula | C24H23N4O5PS |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N-[3-[2-[4-(dimethoxyphosphorylmethyl)anilino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(CP(=O)(OC)OC)cc3)nc3ccsc23)c1 |
| InChI | InChI=1S/C24H23N4O5PS/c1-4-21(29)25-18-6-5-7-19(14-18)33-23-22-20(12-13-35-22)27-24(28-23)26-17-10-8-16(9-11-17)15-34(30,31-2)32-3/h4-14H,1,15H2,2-3H3,(H,25,29)(H,26,27,28) |
| InChIKey | KLLINDCXWFZPSS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|