C22H22N6O2S — CID 162658010
(E)-N-[3-[2-[(1-methylpyrazol-3-yl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]hex-2-enamide (PubChem CID 162658010) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is (E)-N-[3-[2-[(1-methylpyrazol-3-yl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]hex-2-enamide.
| Compound Name | (E)-N-[3-[2-[(1-methylpyrazol-3-yl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]hex-2-enamide |
|---|---|
| PubChem CID | 162658010 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (E)-N-[3-[2-[(1-methylpyrazol-3-yl)amino]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]hex-2-enamide |
| SMILES | CCC/C=C/C(=O)Nc1cccc(Oc2nc(Nc3ccn(C)n3)nc3ccsc23)c1 |
| InChI | InChI=1S/C22H22N6O2S/c1-3-4-5-9-19(29)23-15-7-6-8-16(14-15)30-21-20-17(11-13-31-20)24-22(26-21)25-18-10-12-28(2)27-18/h5-14H,3-4H2,1-2H3,(H,23,29)(H,24,25,26,27)/b9-5+ |
| InChIKey | ZXOSFXMDBVHACY-WEVVVXLNSA-N |
| XLogP | 5.26 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|