C24H19N5O2S — CID 162658973
N-[3-[2-(3-cyanoanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]-3-methylbut-2-enamide (PubChem CID 162658973) has the molecular formula C24H19N5O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[3-[2-(3-cyanoanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]-3-methylbut-2-enamide.
| Compound Name | N-[3-[2-(3-cyanoanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 162658973 |
| Molecular Formula | C24H19N5O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[3-[2-(3-cyanoanilino)thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1cccc(Oc2nc(Nc3cccc(C#N)c3)nc3ccsc23)c1 |
| InChI | InChI=1S/C24H19N5O2S/c1-15(2)11-21(30)26-18-7-4-8-19(13-18)31-23-22-20(9-10-32-22)28-24(29-23)27-17-6-3-5-16(12-17)14-25/h3-13H,1-2H3,(H,26,30)(H,27,28,29) |
| InChIKey | JIEIQKVZVNBOOR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|