About 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole
3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole (PubChem CID 162652042) has the molecular formula C31H33NO
and a molecular weight of 435.61 g/mol. Its IUPAC name is 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole.
Molecular Properties
| Compound Name | 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole |
| PubChem CID | 162652042 |
| Molecular Formula | C31H33NO |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(C(c3ccccc3)c3c[nH]c4ccccc34)cc2c1 |
| InChI | InChI=1S/C31H33NO/c1-30(2,3)22-16-21-17-27(33-29(21)25(18-22)31(4,5)6)28(20-12-8-7-9-13-20)24-19-32-26-15-11-10-14-23(24)26/h7-19,28,32H,1-6H3 |
| InChIKey | YJGXXHGAODOPQZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole?
The IUPAC name of 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole (CID 162652042) is 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole.
What is the SMILES notation for 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole?
The canonical SMILES for 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole is CC(C)(C)c1cc(C(C)(C)C)c2oc(C(c3ccccc3)c3c[nH]c4ccccc34)cc2c1.
What is the InChIKey of 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole?
The InChIKey is YJGXXHGAODOPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H33NO/c1-30(2,3)22-16-21-17-27(33-29(21)25(18-22)31(4,5)6)28(20-12-8-7-9-13-20)24-19-32-26-15-11-10-14-23(24)26/h7-19,28,32H,1-6H3.
What are the key properties of 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole?
3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole has a molecular weight of 435.61 g/mol, XLogP of 8.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole is sourced from PubChem (CID 162652042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).