C31H33NO — CID 162652042
3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole (PubChem CID 162652042) has the molecular formula C31H33NO and a molecular weight of 435.61 g/mol. Its IUPAC name is 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole.
| Compound Name | 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole |
|---|---|
| PubChem CID | 162652042 |
| Molecular Formula | C31H33NO |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-1H-indole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(C(c3ccccc3)c3c[nH]c4ccccc34)cc2c1 |
| InChI | InChI=1S/C31H33NO/c1-30(2,3)22-16-21-17-27(33-29(21)25(18-22)31(4,5)6)28(20-12-8-7-9-13-20)24-19-32-26-15-11-10-14-23(24)26/h7-19,28,32H,1-6H3 |
| InChIKey | YJGXXHGAODOPQZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |