C22H14N2O4 — CID 162652101
3-(benzimidazol-1-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione (PubChem CID 162652101) has the molecular formula C22H14N2O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is 3-(benzimidazol-1-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 3-(benzimidazol-1-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 162652101 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-(benzimidazol-1-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(Cn3cnc4ccccc43)cc21 |
| InChI | InChI=1S/C22H14N2O4/c25-17-7-3-4-13-19(17)22(28)20-14(21(13)27)8-12(9-18(20)26)10-24-11-23-15-5-1-2-6-16(15)24/h1-9,11,25-26H,10H2 |
| InChIKey | ASVJQWCIUAOQMT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|