C22H13N3O6 — CID 162652075
1,8-dihydroxy-3-[(5-nitrobenzimidazol-1-yl)methyl]anthracene-9,10-dione (PubChem CID 162652075) has the molecular formula C22H13N3O6 and a molecular weight of 415.36 g/mol. Its IUPAC name is 1,8-dihydroxy-3-[(5-nitrobenzimidazol-1-yl)methyl]anthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-3-[(5-nitrobenzimidazol-1-yl)methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 162652075 |
| Molecular Formula | C22H13N3O6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1,8-dihydroxy-3-[(5-nitrobenzimidazol-1-yl)methyl]anthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(Cn3cnc4cc([N+](=O)[O-])ccc43)cc21 |
| InChI | InChI=1S/C22H13N3O6/c26-17-3-1-2-13-19(17)22(29)20-14(21(13)28)6-11(7-18(20)27)9-24-10-23-15-8-12(25(30)31)4-5-16(15)24/h1-8,10,26-27H,9H2 |
| InChIKey | OZOAOEWBFGKQPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|