C22H19N3O6 — CID 162653558
1-[2-(3,4-dihydroxyphenyl)ethylamino]-7-methoxy-4-nitro-10H-acridin-9-one (PubChem CID 162653558) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)ethylamino]-7-methoxy-4-nitro-10H-acridin-9-one.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)ethylamino]-7-methoxy-4-nitro-10H-acridin-9-one |
|---|---|
| PubChem CID | 162653558 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)ethylamino]-7-methoxy-4-nitro-10H-acridin-9-one |
| SMILES | COc1ccc2[nH]c3c([N+](=O)[O-])ccc(NCCc4ccc(O)c(O)c4)c3c(=O)c2c1 |
| InChI | InChI=1S/C22H19N3O6/c1-31-13-3-4-15-14(11-13)22(28)20-16(5-6-17(25(29)30)21(20)24-15)23-9-8-12-2-7-18(26)19(27)10-12/h2-7,10-11,23,26-27H,8-9H2,1H3,(H,24,28) |
| InChIKey | GLHQLDTURCSJIU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|