C21H27N5O4 — CID 10740458
1-[2-[2-(diethylamino)ethylamino]ethylamino]-7-hydroxy-4-nitro-10H-acridin-9-one (PubChem CID 10740458) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[2-[2-(diethylamino)ethylamino]ethylamino]-7-hydroxy-4-nitro-10H-acridin-9-one.
| Compound Name | 1-[2-[2-(diethylamino)ethylamino]ethylamino]-7-hydroxy-4-nitro-10H-acridin-9-one |
|---|---|
| PubChem CID | 10740458 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[2-[2-(diethylamino)ethylamino]ethylamino]-7-hydroxy-4-nitro-10H-acridin-9-one |
| SMILES | CCN(CC)CCNCCNc1ccc([N+](=O)[O-])c2[nH]c3ccc(O)cc3c(=O)c12 |
| InChI | InChI=1S/C21H27N5O4/c1-3-25(4-2)12-11-22-9-10-23-17-7-8-18(26(29)30)20-19(17)21(28)15-13-14(27)5-6-16(15)24-20/h5-8,13,22-23,27H,3-4,9-12H2,1-2H3,(H,24,28) |
| InChIKey | GMNWQLHUMSWDFZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|