C17H22N4O — CID 169316038
4-[2-(diethylamino)ethylamino]-2,9-dihydropyrido[3,4-b]indol-1-one (PubChem CID 169316038) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethylamino]-2,9-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 4-[2-(diethylamino)ethylamino]-2,9-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 169316038 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-[2-(diethylamino)ethylamino]-2,9-dihydropyrido[3,4-b]indol-1-one |
| SMILES | CCN(CC)CCNc1c[nH]c(=O)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C17H22N4O/c1-3-21(4-2)10-9-18-14-11-19-17(22)16-15(14)12-7-5-6-8-13(12)20-16/h5-8,11,18,20H,3-4,9-10H2,1-2H3,(H,19,22) |
| InChIKey | LCOJYTOGSWCPED-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |