C20H27N3 — CID 91570877
N,N-diethyl-2-[4-methyl-5-(3-methyl-1H-indol-2-yl)-1H-pyrrol-3-yl]ethanamine (PubChem CID 91570877) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is N,N-diethyl-2-[4-methyl-5-(3-methyl-1H-indol-2-yl)-1H-pyrrol-3-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[4-methyl-5-(3-methyl-1H-indol-2-yl)-1H-pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 91570877 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N,N-diethyl-2-[4-methyl-5-(3-methyl-1H-indol-2-yl)-1H-pyrrol-3-yl]ethanamine |
| SMILES | CCN(CC)CCc1c[nH]c(-c2[nH]c3ccccc3c2C)c1C |
| InChI | InChI=1S/C20H27N3/c1-5-23(6-2)12-11-16-13-21-19(14(16)3)20-15(4)17-9-7-8-10-18(17)22-20/h7-10,13,21-22H,5-6,11-12H2,1-4H3 |
| InChIKey | CQDXHYXJMKXCSV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|