C21H28N4O3 — CID 10548076
4-amino-1-[2-(diethylamino)ethylamino]-6,7-dimethoxy-10H-acridin-9-one (PubChem CID 10548076) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-amino-1-[2-(diethylamino)ethylamino]-6,7-dimethoxy-10H-acridin-9-one.
| Compound Name | 4-amino-1-[2-(diethylamino)ethylamino]-6,7-dimethoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 10548076 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-amino-1-[2-(diethylamino)ethylamino]-6,7-dimethoxy-10H-acridin-9-one |
| SMILES | CCN(CC)CCNc1ccc(N)c2[nH]c3cc(OC)c(OC)cc3c(=O)c12 |
| InChI | InChI=1S/C21H28N4O3/c1-5-25(6-2)10-9-23-15-8-7-14(22)20-19(15)21(26)13-11-17(27-3)18(28-4)12-16(13)24-20/h7-8,11-12,23H,5-6,9-10,22H2,1-4H3,(H,24,26) |
| InChIKey | VKKUKIUXOYLXEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|