C18H15N3O — CID 169316028
4-(3-methylanilino)-2,9-dihydropyrido[3,4-b]indol-1-one (PubChem CID 169316028) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(3-methylanilino)-2,9-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 4-(3-methylanilino)-2,9-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 169316028 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-(3-methylanilino)-2,9-dihydropyrido[3,4-b]indol-1-one |
| SMILES | Cc1cccc(Nc2c[nH]c(=O)c3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C18H15N3O/c1-11-5-4-6-12(9-11)20-15-10-19-18(22)17-16(15)13-7-2-3-8-14(13)21-17/h2-10,20-21H,1H3,(H,19,22) |
| InChIKey | FSHNWKYALUKDAF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |