C27H29N3O — CID 162654341
N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 162654341) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 162654341 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N[C@@H](Cc1ccccc1)CN(C)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O/c1-20-25(24-15-9-10-16-26(24)28-20)18-27(31)29-22(17-21-11-5-3-6-12-21)19-30(2)23-13-7-4-8-14-23/h3-16,22,28H,17-19H2,1-2H3,(H,29,31)/t22-/m0/s1 |
| InChIKey | NSJWJSJGSIILRK-QFIPXVFZSA-N |
| XLogP | 4.88 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|