C24H24N6O4 — CID 162654393
7-[6-[4-(benzotriazol-1-yloxymethyl)triazol-1-yl]hexoxy]chromen-2-one (PubChem CID 162654393) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is 7-[6-[4-(benzotriazol-1-yloxymethyl)triazol-1-yl]hexoxy]chromen-2-one.
| Compound Name | 7-[6-[4-(benzotriazol-1-yloxymethyl)triazol-1-yl]hexoxy]chromen-2-one |
|---|---|
| PubChem CID | 162654393 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 7-[6-[4-(benzotriazol-1-yloxymethyl)triazol-1-yl]hexoxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(OCCCCCCn3cc(COn4nnc5ccccc54)nn3)cc2o1 |
| InChI | InChI=1S/C24H24N6O4/c31-24-12-10-18-9-11-20(15-23(18)34-24)32-14-6-2-1-5-13-29-16-19(25-27-29)17-33-30-22-8-4-3-7-21(22)26-28-30/h3-4,7-12,15-16H,1-2,5-6,13-14,17H2 |
| InChIKey | PHSRFYJHJLGCBZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|