C25H26N8O7 — CID 24766814
7-[[1-[3-[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxypropyl]triazol-4-yl]methoxy]chromen-2-one (PubChem CID 24766814) has the molecular formula C25H26N8O7 and a molecular weight of 550.53 g/mol. Its IUPAC name is 7-[[1-[3-[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxypropyl]triazol-4-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[1-[3-[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxypropyl]triazol-4-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 24766814 |
| Molecular Formula | C25H26N8O7 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 7-[[1-[3-[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxypropyl]triazol-4-yl]methoxy]chromen-2-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OCCCn1cc(COc2ccc3ccc(=O)oc3c2)nn1 |
| InChI | InChI=1S/C25H26N8O7/c26-23-20-24(28-12-27-23)33(13-29-20)25-22(21(36)18(10-34)40-25)37-7-1-6-32-9-15(30-31-32)11-38-16-4-2-14-3-5-19(35)39-17(14)8-16/h2-5,8-9,12-13,18,21-22,25,34,36H,1,6-7,10-11H2,(H2,26,27,28)/t18-,21-,22-,25-/m1/s1 |
| InChIKey | YNNPWPJWKKKZTI-PXOHRUDZSA-N |
| XLogP | 0.41 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|