C19H9ClN2O2 — CID 162657598
18-chloro-10,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),3(11),4,6,8,13,15,17,19-nonaene-2,12-dione (PubChem CID 162657598) has the molecular formula C19H9ClN2O2 and a molecular weight of 332.75 g/mol. Its IUPAC name is 18-chloro-10,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),3(11),4,6,8,13,15,17,19-nonaene-2,12-dione.
| Compound Name | 18-chloro-10,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),3(11),4,6,8,13,15,17,19-nonaene-2,12-dione |
|---|---|
| PubChem CID | 162657598 |
| Molecular Formula | C19H9ClN2O2 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 18-chloro-10,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),3(11),4,6,8,13,15,17,19-nonaene-2,12-dione |
| SMILES | O=C1c2cnc3c(Cl)cccc3c2C(=O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C19H9ClN2O2/c20-12-6-3-5-10-14-11(8-21-16(10)12)18(23)15-9-4-1-2-7-13(9)22-17(15)19(14)24/h1-8,22H |
| InChIKey | CQAQEODTPOQVNC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|