C22H24N2O4S — CID 162657624
methyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate (PubChem CID 162657624) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 162657624 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate |
| SMILES | CCN(CC)Cc1ccc2c(C(=O)OC)c(NC(=O)c3ccccc3)sc2c1O |
| InChI | InChI=1S/C22H24N2O4S/c1-4-24(5-2)13-15-11-12-16-17(22(27)28-3)21(29-19(16)18(15)25)23-20(26)14-9-7-6-8-10-14/h6-12,25H,4-5,13H2,1-3H3,(H,23,26) |
| InChIKey | TWQAYWKNEGMUNW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|