C23H26ClN2O4S- — CID 53314549
ethyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate chloride (PubChem CID 53314549) has the molecular formula C23H26ClN2O4S- and a molecular weight of 461.99 g/mol. Its IUPAC name is ethyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate chloride.
| Compound Name | ethyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate chloride |
|---|---|
| PubChem CID | 53314549 |
| Molecular Formula | C23H26ClN2O4S- |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | ethyl 2-benzamido-6-(diethylaminomethyl)-7-hydroxy-1-benzothiophene-3-carboxylate chloride |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2)sc2c(O)c(CN(CC)CC)ccc12.[Cl-] |
| InChI | InChI=1S/C23H26N2O4S.ClH/c1-4-25(5-2)14-16-12-13-17-18(23(28)29-6-3)22(30-20(17)19(16)26)24-21(27)15-10-8-7-9-11-15;/h7-13,26H,4-6,14H2,1-3H3,(H,24,27);1H/p-1 |
| InChIKey | FRNFXNPOJTVGPU-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|