C18H17N5O2S — CID 162658675
N-[[2-[[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]phenyl]methyl]prop-2-enamide (PubChem CID 162658675) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[[2-[[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 162658675 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[[2-[[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1NC(=O)CSc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C18H17N5O2S/c1-2-15(24)20-10-12-6-3-4-7-13(12)21-16(25)11-26-18-22-14-8-5-9-19-17(14)23-18/h2-9H,1,10-11H2,(H,20,24)(H,21,25)(H,19,22,23) |
| InChIKey | LGEICHGHNXDEEN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|