C37H47NO3 — CID 162658727
(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-N-[(2-methylphenyl)methyl]-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide (PubChem CID 162658727) has the molecular formula C37H47NO3 and a molecular weight of 553.79 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-N-[(2-methylphenyl)methyl]-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-N-[(2-methylphenyl)methyl]-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 162658727 |
| Molecular Formula | C37H47NO3 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-N-[(2-methylphenyl)methyl]-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)NCc4ccccc4C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C37H47NO3/c1-23-10-8-9-11-25(23)22-38-32(41)34(4)15-14-33(3)16-18-36(6)29-13-12-26-24(2)31(40)28(39)20-27(26)35(29,5)17-19-37(36,7)30(33)21-34/h8-13,20,30,40H,14-19,21-22H2,1-7H3,(H,38,41)/t30-,33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | JJKQXLDKEFZJSP-SUNMMQDUSA-N |
| XLogP | 8.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |