C25H20F2N6O3 — CID 162658849
N-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 162658849) has the molecular formula C25H20F2N6O3 and a molecular weight of 490.47 g/mol. Its IUPAC name is N-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162658849 |
| Molecular Formula | C25H20F2N6O3 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[4-[2-(2-aminoanilino)-2-oxoethyl]phenyl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | Nc1ccccc1NC(=O)Cc1ccc(NC(=O)c2[nH]ncc2NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C25H20F2N6O3/c26-16-4-3-5-17(27)22(16)24(35)32-20-13-29-33-23(20)25(36)30-15-10-8-14(9-11-15)12-21(34)31-19-7-2-1-6-18(19)28/h1-11,13H,12,28H2,(H,29,33)(H,30,36)(H,31,34)(H,32,35) |
| InChIKey | UFDNTTYCONJEOJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|