C20H17FN4O2 — CID 162661448
5-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1-[(4-fluorophenyl)methyl]imidazole-4-carbonitrile (PubChem CID 162661448) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is 5-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1-[(4-fluorophenyl)methyl]imidazole-4-carbonitrile.
| Compound Name | 5-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1-[(4-fluorophenyl)methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 162661448 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-1-[(4-fluorophenyl)methyl]imidazole-4-carbonitrile |
| SMILES | COc1ccc(/C=N/c2c(C#N)ncn2Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C20H17FN4O2/c1-26-18-8-5-15(9-19(18)27-2)11-23-20-17(10-22)24-13-25(20)12-14-3-6-16(21)7-4-14/h3-9,11,13H,12H2,1-2H3/b23-11+ |
| InChIKey | JXGAAFRGGLTMIC-FOKLQQMPSA-N |
| XLogP | 3.71 |
| TPSA | 72.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|