C30H36FN9O2 — CID 162661572
ethyl 2-[(3S)-3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]pyrrolidin-1-yl]acetate (PubChem CID 162661572) has the molecular formula C30H36FN9O2 and a molecular weight of 573.68 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]pyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(3S)-3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 162661572 |
| Molecular Formula | C30H36FN9O2 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | ethyl 2-[(3S)-3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CC[C@H](n2c(Nc3ccc(F)cc3)nc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C30H36FN9O2/c1-3-42-27(41)20-38-13-12-25(19-38)40-28-26(35-30(40)34-23-6-4-21(31)5-7-23)18-32-29(36-28)33-22-8-10-24(11-9-22)39-16-14-37(2)15-17-39/h4-11,18,25H,3,12-17,19-20H2,1-2H3,(H,34,35)(H,32,33,36)/t25-/m0/s1 |
| InChIKey | BROIYAQLTPUOLM-VWLOTQADSA-N |
| XLogP | 4.01 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|