C20H18N6O2 — CID 162662256
1-(5-methyl-1,2-oxazol-3-yl)-3-[3-[(quinazolin-4-ylamino)methyl]phenyl]urea (PubChem CID 162662256) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-[3-[(quinazolin-4-ylamino)methyl]phenyl]urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-[3-[(quinazolin-4-ylamino)methyl]phenyl]urea |
|---|---|
| PubChem CID | 162662256 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-[3-[(quinazolin-4-ylamino)methyl]phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cccc(CNc3ncnc4ccccc34)c2)no1 |
| InChI | InChI=1S/C20H18N6O2/c1-13-9-18(26-28-13)25-20(27)24-15-6-4-5-14(10-15)11-21-19-16-7-2-3-8-17(16)22-12-23-19/h2-10,12H,11H2,1H3,(H,21,22,23)(H2,24,25,26,27) |
| InChIKey | KYQMUYAKNGHQKN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |