C14H22N6O3S — CID 162662950
N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]benzenesulfonamide (PubChem CID 162662950) has the molecular formula C14H22N6O3S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]benzenesulfonamide.
| Compound Name | N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162662950 |
| Molecular Formula | C14H22N6O3S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]benzenesulfonamide |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H22N6O3S/c1-14(2)19-12(15)18-13(16)20(14)23-10-6-9-17-24(21,22)11-7-4-3-5-8-11/h3-5,7-8,17H,6,9-10H2,1-2H3,(H4,15,16,18,19) |
| InChIKey | RSRBMAGKCYGHKE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|