C16H25N5O4 — CID 44523074
1-[3-(2,6-dimethoxyphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 44523074) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[3-(2,6-dimethoxyphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-[3-(2,6-dimethoxyphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 44523074 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[3-(2,6-dimethoxyphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cccc(OC)c1OCCCON1C(N)=NC(N)=NC1(C)C |
| InChI | InChI=1S/C16H25N5O4/c1-16(2)20-14(17)19-15(18)21(16)25-10-6-9-24-13-11(22-3)7-5-8-12(13)23-4/h5,7-8H,6,9-10H2,1-4H3,(H4,17,18,19,20) |
| InChIKey | WVNYRMNOAFRTRE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|