C22H37N5O2 — CID 3008692
1-[(4-decoxyphenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 3008692) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(4-decoxyphenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-[(4-decoxyphenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3008692 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 1-[(4-decoxyphenyl)methoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCCCOc1ccc(CON2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C22H37N5O2/c1-4-5-6-7-8-9-10-11-16-28-19-14-12-18(13-15-19)17-29-27-21(24)25-20(23)26-22(27,2)3/h12-15H,4-11,16-17H2,1-3H3,(H4,23,24,25,26) |
| InChIKey | CCEOUUUBJBUHTP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|