C14H21N5O2 — CID 134098766
6,6-dimethyl-1-[2-(4-methylphenoxy)ethoxy]-1,3,5-triazine-2,4-diamine (PubChem CID 134098766) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 6,6-dimethyl-1-[2-(4-methylphenoxy)ethoxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-[2-(4-methylphenoxy)ethoxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134098766 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 6,6-dimethyl-1-[2-(4-methylphenoxy)ethoxy]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(OCCON2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C14H21N5O2/c1-10-4-6-11(7-5-10)20-8-9-21-19-13(16)17-12(15)18-14(19,2)3/h4-7H,8-9H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | FDVLLBGXVZTCBX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|