C16H26BrN5O2 — CID 44522509
1-[3-(3-ethylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide (PubChem CID 44522509) has the molecular formula C16H26BrN5O2 and a molecular weight of 400.32 g/mol. Its IUPAC name is 1-[3-(3-ethylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide.
| Compound Name | 1-[3-(3-ethylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
|---|---|
| PubChem CID | 44522509 |
| Molecular Formula | C16H26BrN5O2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[3-(3-ethylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
| SMILES | Br.CCc1cccc(OCCCON2C(N)=NC(N)=NC2(C)C)c1 |
| InChI | InChI=1S/C16H25N5O2.BrH/c1-4-12-7-5-8-13(11-12)22-9-6-10-23-21-15(18)19-14(17)20-16(21,2)3;/h5,7-8,11H,4,6,9-10H2,1-3H3,(H4,17,18,19,20);1H |
| InChIKey | PCYXKGMLEPBNKA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|