C21H27N5O2 — CID 134116988
6,6-dimethyl-1-[[3-(3-phenylpropoxy)phenyl]methoxy]-1,3,5-triazine-2,4-diamine (PubChem CID 134116988) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 6,6-dimethyl-1-[[3-(3-phenylpropoxy)phenyl]methoxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-[[3-(3-phenylpropoxy)phenyl]methoxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134116988 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 6,6-dimethyl-1-[[3-(3-phenylpropoxy)phenyl]methoxy]-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C21H27N5O2/c1-21(2)25-19(22)24-20(23)26(21)28-15-17-10-6-12-18(14-17)27-13-7-11-16-8-4-3-5-9-16/h3-6,8-10,12,14H,7,11,13,15H2,1-2H3,(H4,22,23,24,25) |
| InChIKey | RJOOZKRDRPEFTK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|