C18H29N5O3 — CID 44522559
1-[3-(2-methoxy-6-propylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 44522559) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[3-(2-methoxy-6-propylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-[3-(2-methoxy-6-propylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 44522559 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[3-(2-methoxy-6-propylphenoxy)propoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCc1cccc(OC)c1OCCCON1C(N)=NC(N)=NC1(C)C |
| InChI | InChI=1S/C18H29N5O3/c1-5-8-13-9-6-10-14(24-4)15(13)25-11-7-12-26-23-17(20)21-16(19)22-18(23,2)3/h6,9-10H,5,7-8,11-12H2,1-4H3,(H4,19,20,21,22) |
| InChIKey | CYOQDBWYHRFSKV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|