C12H25N5O — CID 3008677
1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 3008677) has the molecular formula C12H25N5O and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3008677 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCON1C(N)=NC(N)=NC1(C)C |
| InChI | InChI=1S/C12H25N5O/c1-4-5-6-7-8-9-18-17-11(14)15-10(13)16-12(17,2)3/h4-9H2,1-3H3,(H4,13,14,15,16) |
| InChIKey | JKRNGUIEZVKTLV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|