C12H26BrN5O — CID 134100560
1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide (PubChem CID 134100560) has the molecular formula C12H26BrN5O and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide.
| Compound Name | 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
|---|---|
| PubChem CID | 134100560 |
| Molecular Formula | C12H26BrN5O |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-heptoxy-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrobromide |
| SMILES | Br.CCCCCCCON1C(N)=NC(N)=NC1(C)C |
| InChI | InChI=1S/C12H25N5O.BrH/c1-4-5-6-7-8-9-18-17-11(14)15-10(13)16-12(17,2)3;/h4-9H2,1-3H3,(H4,13,14,15,16);1H |
| InChIKey | YQEKOQIRGIJMKE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|