C15H21Cl2N5O — CID 134110678
1-[4-(3,4-dichlorophenyl)butoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 134110678) has the molecular formula C15H21Cl2N5O and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)butoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-[4-(3,4-dichlorophenyl)butoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134110678 |
| Molecular Formula | C15H21Cl2N5O |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)butoxy]-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1OCCCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2N5O/c1-15(2)21-13(18)20-14(19)22(15)23-8-4-3-5-10-6-7-11(16)12(17)9-10/h6-7,9H,3-5,8H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | RPWBHHJXGHKCJB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|