C19H27N5O3 — CID 56669826
1-[4-[3-[(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)oxy]propoxy]phenyl]ethanone (PubChem CID 56669826) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-[4-[3-[(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)oxy]propoxy]phenyl]ethanone.
| Compound Name | 1-[4-[3-[(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)oxy]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 56669826 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-[4-[3-[(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)oxy]propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCON2C(N)=NC(N)=NC23CCCCC3)cc1 |
| InChI | InChI=1S/C19H27N5O3/c1-14(25)15-6-8-16(9-7-15)26-12-5-13-27-24-18(21)22-17(20)23-19(24)10-3-2-4-11-19/h6-9H,2-5,10-13H2,1H3,(H4,20,21,22,23) |
| InChIKey | DCYDAIOJVOLHBC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|