C16H23ClN4O2 — CID 159252436
1-[3-(2-chloro-4-methylphenoxy)propoxy]-4,6,6-trimethyl-1,3,5-triazin-2-amine (PubChem CID 159252436) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-[3-(2-chloro-4-methylphenoxy)propoxy]-4,6,6-trimethyl-1,3,5-triazin-2-amine.
| Compound Name | 1-[3-(2-chloro-4-methylphenoxy)propoxy]-4,6,6-trimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 159252436 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[3-(2-chloro-4-methylphenoxy)propoxy]-4,6,6-trimethyl-1,3,5-triazin-2-amine |
| SMILES | CC1=NC(C)(C)N(OCCCOc2ccc(C)cc2Cl)C(N)=N1 |
| InChI | InChI=1S/C16H23ClN4O2/c1-11-6-7-14(13(17)10-11)22-8-5-9-23-21-15(18)19-12(2)20-16(21,3)4/h6-7,10H,5,8-9H2,1-4H3,(H2,18,19,20) |
| InChIKey | RHUVWODAOROAGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|