C15H24N6O3S — CID 162664639
N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]-4-methylbenzenesulfonamide (PubChem CID 162664639) has the molecular formula C15H24N6O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162664639 |
| Molecular Formula | C15H24N6O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[3-[(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)oxy]propyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCON2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C15H24N6O3S/c1-11-5-7-12(8-6-11)25(22,23)18-9-4-10-24-21-14(17)19-13(16)20-15(21,2)3/h5-8,18H,4,9-10H2,1-3H3,(H4,16,17,19,20) |
| InChIKey | BRZDSRYXZPJAFD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|