C25H32F2N6 — CID 162663041
N'-[6-[(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine (PubChem CID 162663041) has the molecular formula C25H32F2N6 and a molecular weight of 454.57 g/mol. Its IUPAC name is N'-[6-[(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine.
| Compound Name | N'-[6-[(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 162663041 |
| Molecular Formula | C25H32F2N6 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | N'-[6-[(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NCCNCCCF)cn2)N1CC1(F)CC1 |
| InChI | InChI=1S/C25H32F2N6/c1-17-13-20-19(4-6-22-21(20)15-31-32-22)24(33(17)16-25(27)7-8-25)23-5-3-18(14-30-23)29-12-11-28-10-2-9-26/h3-6,14-15,17,24,28-29H,2,7-13,16H2,1H3,(H,31,32)/t17-,24+/m1/s1 |
| InChIKey | UBXGOMHUKQAISL-OSPHWJPCSA-N |
| XLogP | 4.16 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|