C22H22ClN5O6 — CID 162664087
(3E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-(2-morpholin-4-ylethoxyimino)indol-5-ol;hydrochloride (PubChem CID 162664087) has the molecular formula C22H22ClN5O6 and a molecular weight of 487.90 g/mol. Its IUPAC name is (3E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-(2-morpholin-4-ylethoxyimino)indol-5-ol;hydrochloride.
| Compound Name | (3E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-(2-morpholin-4-ylethoxyimino)indol-5-ol;hydrochloride |
|---|---|
| PubChem CID | 162664087 |
| Molecular Formula | C22H22ClN5O6 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (3E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-(2-morpholin-4-ylethoxyimino)indol-5-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2[nH]c(O)c(C3=Nc4ccc(O)cc4/C3=N\OCCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C22H21N5O6.ClH/c28-14-2-4-18-16(12-14)20(25-33-10-7-26-5-8-32-9-6-26)21(23-18)19-15-11-13(27(30)31)1-3-17(15)24-22(19)29;/h1-4,11-12,24,28-29H,5-10H2;1H/b25-20+; |
| InChIKey | ZMMZIFGXOITCIR-UDLBSFQBSA-N |
| XLogP | 3.10 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|