C23H23FN6O4 — CID 155069277
3-[(3E)-5-fluoro-3-[2-(4-methylpiperazin-1-yl)ethoxyimino]indol-2-yl]-5-nitro-1H-indol-2-ol (PubChem CID 155069277) has the molecular formula C23H23FN6O4 and a molecular weight of 466.47 g/mol. Its IUPAC name is 3-[(3E)-5-fluoro-3-[2-(4-methylpiperazin-1-yl)ethoxyimino]indol-2-yl]-5-nitro-1H-indol-2-ol.
| Compound Name | 3-[(3E)-5-fluoro-3-[2-(4-methylpiperazin-1-yl)ethoxyimino]indol-2-yl]-5-nitro-1H-indol-2-ol |
|---|---|
| PubChem CID | 155069277 |
| Molecular Formula | C23H23FN6O4 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-[(3E)-5-fluoro-3-[2-(4-methylpiperazin-1-yl)ethoxyimino]indol-2-yl]-5-nitro-1H-indol-2-ol |
| SMILES | CN1CCN(CCO/N=C2/C(c3c(O)[nH]c4ccc([N+](=O)[O-])cc34)=Nc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C23H23FN6O4/c1-28-6-8-29(9-7-28)10-11-34-27-21-17-12-14(24)2-4-19(17)25-22(21)20-16-13-15(30(32)33)3-5-18(16)26-23(20)31/h2-5,12-13,26,31H,6-11H2,1H3/b27-21+ |
| InChIKey | XMQMGBHESFWULO-SZXQPVLSSA-N |
| XLogP | 3.02 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|