C23H24FN5O2 — CID 142752486
5-fluoro-3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol (PubChem CID 142752486) has the molecular formula C23H24FN5O2 and a molecular weight of 421.48 g/mol. Its IUPAC name is 5-fluoro-3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-fluoro-3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 142752486 |
| Molecular Formula | C23H24FN5O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 5-fluoro-3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(F)cc2c1C1=Nc2ccccc2/C1=N\OCCNC1CCNCC1 |
| InChI | InChI=1S/C23H24FN5O2/c24-14-5-6-19-17(13-14)20(23(30)28-19)22-21(16-3-1-2-4-18(16)27-22)29-31-12-11-26-15-7-9-25-10-8-15/h1-6,13,15,25-26,28,30H,7-12H2/b29-21+ |
| InChIKey | NSWPRDHVDNYGOA-XHLNEMQHSA-N |
| XLogP | 3.21 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|