C24H27BrN4O2 — CID 136980960
5-bromo-3-[(3E)-3-[2-[methyl(3-methylbutyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol (PubChem CID 136980960) has the molecular formula C24H27BrN4O2 and a molecular weight of 483.41 g/mol. Its IUPAC name is 5-bromo-3-[(3E)-3-[2-[methyl(3-methylbutyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[(3E)-3-[2-[methyl(3-methylbutyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 136980960 |
| Molecular Formula | C24H27BrN4O2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 5-bromo-3-[(3E)-3-[2-[methyl(3-methylbutyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
| SMILES | CC(C)CCN(C)CCO/N=C1/C(c2c(O)[nH]c3ccc(Br)cc23)=Nc2ccccc21 |
| InChI | InChI=1S/C24H27BrN4O2/c1-15(2)10-11-29(3)12-13-31-28-22-17-6-4-5-7-19(17)26-23(22)21-18-14-16(25)8-9-20(18)27-24(21)30/h4-9,14-15,27,30H,10-13H2,1-3H3/b28-22+ |
| InChIKey | BZSQBDPKUAGZJX-XAYXJRQQSA-N |
| XLogP | 5.47 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|