C26H32BrN5O2+2 — CID 163896906
2-[[2-(5-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-dimethyl-(1-methylpiperidin-1-ium-4-yl)azanium (PubChem CID 163896906) has the molecular formula C26H32BrN5O2+2 and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-[[2-(5-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-dimethyl-(1-methylpiperidin-1-ium-4-yl)azanium.
| Compound Name | 2-[[2-(5-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-dimethyl-(1-methylpiperidin-1-ium-4-yl)azanium |
|---|---|
| PubChem CID | 163896906 |
| Molecular Formula | C26H32BrN5O2+2 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[[2-(5-bromo-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl-dimethyl-(1-methylpiperidin-1-ium-4-yl)azanium |
| SMILES | C[NH+]1CCC([N+](C)(C)CCON=C2C(c3c(O)[nH]c4ccc(Br)cc34)=Nc3ccccc32)CC1 |
| InChI | InChI=1S/C26H30BrN5O2/c1-31-12-10-18(11-13-31)32(2,3)14-15-34-30-24-19-6-4-5-7-21(19)28-25(24)23-20-16-17(27)8-9-22(20)29-26(23)33/h4-9,16,18H,10-15H2,1-3H3,(H-,28,29,30,33)/p+2 |
| InChIKey | UCQKAHKDUOTWQR-UHFFFAOYSA-P |
| XLogP | 3.24 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|